C18H23N5O — CID 97051060
(4aR,7aS)-N-[(1-phenyltriazol-4-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide (PubChem CID 97051060) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (4aR,7aS)-N-[(1-phenyltriazol-4-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide.
| Compound Name | (4aR,7aS)-N-[(1-phenyltriazol-4-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 97051060 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (4aR,7aS)-N-[(1-phenyltriazol-4-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)nn1)N1CCC[C@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C18H23N5O/c24-18(22-11-5-7-14-6-4-10-17(14)22)19-12-15-13-23(21-20-15)16-8-2-1-3-9-16/h1-3,8-9,13-14,17H,4-7,10-12H2,(H,19,24)/t14-,17+/m1/s1 |
| InChIKey | YSKHIIIGRWJDHB-PBHICJAKSA-N |
| XLogP | 2.74 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |