C17H27F3N2O2 — CID 97051473
1-[(2S)-4-methyl-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]piperidin-2-one (PubChem CID 97051473) has the molecular formula C17H27F3N2O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[(2S)-4-methyl-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]piperidin-2-one.
| Compound Name | 1-[(2S)-4-methyl-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]piperidin-2-one |
|---|---|
| PubChem CID | 97051473 |
| Molecular Formula | C17H27F3N2O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(2S)-4-methyl-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]piperidin-2-one |
| SMILES | CC(C)C[C@@H](C(=O)N1CCC(C(F)(F)F)CC1)N1CCCCC1=O |
| InChI | InChI=1S/C17H27F3N2O2/c1-12(2)11-14(22-8-4-3-5-15(22)23)16(24)21-9-6-13(7-10-21)17(18,19)20/h12-14H,3-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | NEXPCKAARYFNHC-AWEZNQCLSA-N |
| XLogP | 3.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |