C19H29N3O2 — CID 97051485
(2R)-4-methyl-N-[2-(6-methyl-3-pyridinyl)ethyl]-2-(2-oxopiperidin-1-yl)pentanamide (PubChem CID 97051485) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (2R)-4-methyl-N-[2-(6-methyl-3-pyridinyl)ethyl]-2-(2-oxopiperidin-1-yl)pentanamide.
| Compound Name | (2R)-4-methyl-N-[2-(6-methyl-3-pyridinyl)ethyl]-2-(2-oxopiperidin-1-yl)pentanamide |
|---|---|
| PubChem CID | 97051485 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (2R)-4-methyl-N-[2-(6-methyl-3-pyridinyl)ethyl]-2-(2-oxopiperidin-1-yl)pentanamide |
| SMILES | Cc1ccc(CCNC(=O)[C@@H](CC(C)C)N2CCCCC2=O)cn1 |
| InChI | InChI=1S/C19H29N3O2/c1-14(2)12-17(22-11-5-4-6-18(22)23)19(24)20-10-9-16-8-7-15(3)21-13-16/h7-8,13-14,17H,4-6,9-12H2,1-3H3,(H,20,24)/t17-/m1/s1 |
| InChIKey | RMTRZENVVIVNAF-QGZVFWFLSA-N |
| XLogP | 2.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |