C18H18F3NO2 — CID 97051794
N-[(3R)-oxan-3-yl]-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide (PubChem CID 97051794) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-[(3R)-oxan-3-yl]-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide.
| Compound Name | N-[(3R)-oxan-3-yl]-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 97051794 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[(3R)-oxan-3-yl]-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide |
| SMILES | O=C(c1ccc2ccccc2c1)N(CC(F)(F)F)[C@@H]1CCCOC1 |
| InChI | InChI=1S/C18H18F3NO2/c19-18(20,21)12-22(16-6-3-9-24-11-16)17(23)15-8-7-13-4-1-2-5-14(13)10-15/h1-2,4-5,7-8,10,16H,3,6,9,11-12H2/t16-/m1/s1 |
| InChIKey | JUJCERULXVTZDW-MRXNPFEDSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |