About 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide
5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide (PubChem CID 97052488) has the molecular formula C17H14F2N4O
and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide |
| PubChem CID | 97052488 |
| Molecular Formula | C17H14F2N4O |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)N[C@H]2CCN(c3c(F)cccc3F)C2)nc1 |
| InChI | InChI=1S/C17H14F2N4O/c18-13-2-1-3-14(19)16(13)23-7-6-12(10-23)22-17(24)15-5-4-11(8-20)9-21-15/h1-5,9,12H,6-7,10H2,(H,22,24)/t12-/m0/s1 |
| InChIKey | MNJXQZRBDWNNMO-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide?
The IUPAC name of 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide (CID 97052488) is 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide.
What is the SMILES notation for 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide?
The canonical SMILES for 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide is N#Cc1ccc(C(=O)N[C@H]2CCN(c3c(F)cccc3F)C2)nc1.
What is the InChIKey of 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide?
The InChIKey is MNJXQZRBDWNNMO-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H14F2N4O/c18-13-2-1-3-14(19)16(13)23-7-6-12(10-23)22-17(24)15-5-4-11(8-20)9-21-15/h1-5,9,12H,6-7,10H2,(H,22,24)/t12-/m0/s1.
What are the key properties of 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide?
5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide has a molecular weight of 328.32 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-[(3S)-1-(2,6-difluorophenyl)pyrrolidin-3-yl]pyridine-2-carboxamide is sourced from PubChem (CID 97052488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).