C17H20N6O2 — CID 97054067
1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-(2-methyl-1,3-benzoxazol-6-yl)urea (PubChem CID 97054067) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-(2-methyl-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-(2-methyl-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 97054067 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-(2-methyl-1,3-benzoxazol-6-yl)urea |
| SMILES | CCc1nc2n(n1)CCC[C@H]2NC(=O)Nc1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C17H20N6O2/c1-3-15-21-16-13(5-4-8-23(16)22-15)20-17(24)19-11-6-7-12-14(9-11)25-10(2)18-12/h6-7,9,13H,3-5,8H2,1-2H3,(H2,19,20,24)/t13-/m1/s1 |
| InChIKey | MKDKLICNDFPVCU-CYBMUJFWSA-N |
| XLogP | 2.95 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |