About (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one
(3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one (PubChem CID 97054643) has the molecular formula C14H17F2NO2S
and a molecular weight of 301.36 g/mol. Its IUPAC name is (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one |
| PubChem CID | 97054643 |
| Molecular Formula | C14H17F2NO2S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one |
| SMILES | CCOCCS[C@@H]1CCN(c2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C14H17F2NO2S/c1-2-19-8-9-20-12-6-7-17(14(12)18)13-10(15)4-3-5-11(13)16/h3-5,12H,2,6-9H2,1H3/t12-/m1/s1 |
| InChIKey | SLCJUFOVWQAILR-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one?
The IUPAC name of (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one (CID 97054643) is (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one.
What is the SMILES notation for (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one?
The canonical SMILES for (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one is CCOCCS[C@@H]1CCN(c2c(F)cccc2F)C1=O.
What is the InChIKey of (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one?
The InChIKey is SLCJUFOVWQAILR-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H17F2NO2S/c1-2-19-8-9-20-12-6-7-17(14(12)18)13-10(15)4-3-5-11(13)16/h3-5,12H,2,6-9H2,1H3/t12-/m1/s1.
What are the key properties of (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one?
(3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one has a molecular weight of 301.36 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,6-difluorophenyl)-3-(2-ethoxyethylsulfanyl)pyrrolidin-2-one is sourced from PubChem (CID 97054643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).