C15H25N5O2 — CID 97055232
1-[2-(cyclopropylmethoxy)ethyl]-1-methyl-3-[(8S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea (PubChem CID 97055232) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-1-methyl-3-[(8S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-1-methyl-3-[(8S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea |
|---|---|
| PubChem CID | 97055232 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-1-methyl-3-[(8S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea |
| SMILES | Cc1nnc2n1CCC[C@@H]2NC(=O)N(C)CCOCC1CC1 |
| InChI | InChI=1S/C15H25N5O2/c1-11-17-18-14-13(4-3-7-20(11)14)16-15(21)19(2)8-9-22-10-12-5-6-12/h12-13H,3-10H2,1-2H3,(H,16,21)/t13-/m0/s1 |
| InChIKey | CDIOOOUKQDJRAG-ZDUSSCGKSA-N |
| XLogP | 1.49 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|