About 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea
1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea (PubChem CID 97055329) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea |
| PubChem CID | 97055329 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea |
| SMILES | O=C(NCc1cn(-c2ccccc2)nn1)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H21N5O2/c22-15-9-5-4-8-14(15)18-16(23)17-10-12-11-21(20-19-12)13-6-2-1-3-7-13/h1-3,6-7,11,14-15,22H,4-5,8-10H2,(H2,17,18,23)/t14-,15-/m0/s1 |
| InChIKey | AQIJALHRDWULMA-GJZGRUSLSA-N |
| XLogP | 1.37 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
The IUPAC name of 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea (CID 97055329) is 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea.
What is the SMILES notation for 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
The canonical SMILES for 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea is O=C(NCc1cn(-c2ccccc2)nn1)N[C@H]1CCCC[C@@H]1O.
What is the InChIKey of 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
The InChIKey is AQIJALHRDWULMA-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H21N5O2/c22-15-9-5-4-8-14(15)18-16(23)17-10-12-11-21(20-19-12)13-6-2-1-3-7-13/h1-3,6-7,11,14-15,22H,4-5,8-10H2,(H2,17,18,23)/t14-,15-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea has a molecular weight of 315.38 g/mol, XLogP of 1.37, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-hydroxycyclohexyl]-3-[(1-phenyltriazol-4-yl)methyl]urea is sourced from PubChem (CID 97055329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).