C17H29N3O2 — CID 97055608
2-(methoxymethyl)-4-methyl-6-[(2R)-2-(2-propan-2-yloxyethyl)piperidin-1-yl]pyrimidine (PubChem CID 97055608) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-methyl-6-[(2R)-2-(2-propan-2-yloxyethyl)piperidin-1-yl]pyrimidine.
| Compound Name | 2-(methoxymethyl)-4-methyl-6-[(2R)-2-(2-propan-2-yloxyethyl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 97055608 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-(methoxymethyl)-4-methyl-6-[(2R)-2-(2-propan-2-yloxyethyl)piperidin-1-yl]pyrimidine |
| SMILES | COCc1nc(C)cc(N2CCCC[C@@H]2CCOC(C)C)n1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(2)22-10-8-15-7-5-6-9-20(15)17-11-14(3)18-16(19-17)12-21-4/h11,13,15H,5-10,12H2,1-4H3/t15-/m1/s1 |
| InChIKey | HLVIGFXYUAJHKF-OAHLLOKOSA-N |
| XLogP | 3.11 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |