About [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate
[(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate (PubChem CID 97055873) has the molecular formula C16H15F3N2O3
and a molecular weight of 340.30 g/mol. Its IUPAC name is [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate |
| PubChem CID | 97055873 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate |
| SMILES | Cc1ccccc1[C@@H](OC(=O)c1cc(C(N)=O)cn1C)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O3/c1-9-5-3-4-6-11(9)13(16(17,18)19)24-15(23)12-7-10(14(20)22)8-21(12)2/h3-8,13H,1-2H3,(H2,20,22)/t13-/m1/s1 |
| InChIKey | CERIEZCBGORPBN-CYBMUJFWSA-N |
| XLogP | 2.89 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate?
The IUPAC name of [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate (CID 97055873) is [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate?
The canonical SMILES for [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate is Cc1ccccc1[C@@H](OC(=O)c1cc(C(N)=O)cn1C)C(F)(F)F.
What is the InChIKey of [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate?
The InChIKey is CERIEZCBGORPBN-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H15F3N2O3/c1-9-5-3-4-6-11(9)13(16(17,18)19)24-15(23)12-7-10(14(20)22)8-21(12)2/h3-8,13H,1-2H3,(H2,20,22)/t13-/m1/s1.
What are the key properties of [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate?
[(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate has a molecular weight of 340.30 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 97055873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).