About (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine
(3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 97057018) has the molecular formula C6H6ClN5
and a molecular weight of 183.60 g/mol. Its IUPAC name is (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine |
| PubChem CID | 97057018 |
| Molecular Formula | C6H6ClN5 |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | C[C@@H]1N=Nc2nc(N)nc(Cl)c21 |
| InChI | InChI=1S/C6H6ClN5/c1-2-3-4(7)9-6(8)10-5(3)12-11-2/h2H,1H3,(H2,8,9,10)/t2-/m0/s1 |
| InChIKey | VTRSYEBCVYXABP-REOHCLBHSA-N |
| XLogP | 1.87 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine?
The IUPAC name of (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine (CID 97057018) is (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine.
What is the SMILES notation for (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine?
The canonical SMILES for (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine is C[C@@H]1N=Nc2nc(N)nc(Cl)c21.
What is the InChIKey of (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine?
The InChIKey is VTRSYEBCVYXABP-REOHCLBHSA-N. The full InChI is InChI=1S/C6H6ClN5/c1-2-3-4(7)9-6(8)10-5(3)12-11-2/h2H,1H3,(H2,8,9,10)/t2-/m0/s1.
What are the key properties of (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine?
(3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine has a molecular weight of 183.60 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-chloro-3-methyl-3H-pyrazolo[3,4-d]pyrimidin-6-amine is sourced from PubChem (CID 97057018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).