About (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide
(2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide (PubChem CID 97057371) has the molecular formula C15H16N2O3S
and a molecular weight of 304.37 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide.
Molecular Properties
| Compound Name | (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide |
| PubChem CID | 97057371 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide |
| SMILES | C#CC[C@@H](NS(=O)(=O)C1=Cc2ccccc2CC1)C(N)=O |
| InChI | InChI=1S/C15H16N2O3S/c1-2-5-14(15(16)18)17-21(19,20)13-9-8-11-6-3-4-7-12(11)10-13/h1,3-4,6-7,10,14,17H,5,8-9H2,(H2,16,18)/t14-/m1/s1 |
| InChIKey | WEYZQSSGNAVRHJ-CQSZACIVSA-N |
| XLogP | 0.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide?
The IUPAC name of (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide (CID 97057371) is (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide.
What is the SMILES notation for (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide?
The canonical SMILES for (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide is C#CC[C@@H](NS(=O)(=O)C1=Cc2ccccc2CC1)C(N)=O.
What is the InChIKey of (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide?
The InChIKey is WEYZQSSGNAVRHJ-CQSZACIVSA-N. The full InChI is InChI=1S/C15H16N2O3S/c1-2-5-14(15(16)18)17-21(19,20)13-9-8-11-6-3-4-7-12(11)10-13/h1,3-4,6-7,10,14,17H,5,8-9H2,(H2,16,18)/t14-/m1/s1.
What are the key properties of (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide?
(2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide has a molecular weight of 304.37 g/mol, XLogP of 0.77, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dihydronaphthalen-2-ylsulfonylamino)pent-4-ynamide is sourced from PubChem (CID 97057371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).