C10H6F6N4 — CID 97057892
5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]triazol-4-amine (PubChem CID 97057892) has the molecular formula C10H6F6N4 and a molecular weight of 296.17 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]triazol-4-amine.
| Compound Name | 5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]triazol-4-amine |
|---|---|
| PubChem CID | 97057892 |
| Molecular Formula | C10H6F6N4 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]triazol-4-amine |
| SMILES | Nc1nn(-c2ccccc2C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C10H6F6N4/c11-9(12,13)5-3-1-2-4-6(5)20-18-7(8(17)19-20)10(14,15)16/h1-4H,(H2,17,19) |
| InChIKey | RAGIRZFEDSNZMY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |