About 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea (PubChem CID 97058997) has the molecular formula C14H26N4OS
and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea.
Molecular Properties
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea |
| PubChem CID | 97058997 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea |
| SMILES | CCc1nn(C)c(CC)c1CNC(=O)N[C@H](C)CSC |
| InChI | InChI=1S/C14H26N4OS/c1-6-12-11(13(7-2)18(4)17-12)8-15-14(19)16-10(3)9-20-5/h10H,6-9H2,1-5H3,(H2,15,16,19)/t10-/m1/s1 |
| InChIKey | FIQDSTXMZPTYMI-SNVBAGLBSA-N |
| XLogP | 2.10 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea?
The IUPAC name of 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea (CID 97058997) is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea.
What is the SMILES notation for 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea?
The canonical SMILES for 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea is CCc1nn(C)c(CC)c1CNC(=O)N[C@H](C)CSC.
What is the InChIKey of 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea?
The InChIKey is FIQDSTXMZPTYMI-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H26N4OS/c1-6-12-11(13(7-2)18(4)17-12)8-15-14(19)16-10(3)9-20-5/h10H,6-9H2,1-5H3,(H2,15,16,19)/t10-/m1/s1.
What are the key properties of 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea?
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea has a molecular weight of 298.46 g/mol, XLogP of 2.10, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea is sourced from PubChem (CID 97058997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).