C13H13ClN2OS2 — CID 970598
1-(5-chloro-2-methoxyphenyl)-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 970598) has the molecular formula C13H13ClN2OS2 and a molecular weight of 312.85 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 970598 |
| Molecular Formula | C13H13ClN2OS2 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)NCc1cccs1 |
| InChI | InChI=1S/C13H13ClN2OS2/c1-17-12-5-4-9(14)7-11(12)16-13(18)15-8-10-3-2-6-19-10/h2-7H,8H2,1H3,(H2,15,16,18) |
| InChIKey | BBELYNPZGVDRGS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|