C16H26N4O2 — CID 97060602
1-[(1S,3R)-3-(dimethylamino)cyclohexyl]-3-(2-pyridin-3-yloxyethyl)urea (PubChem CID 97060602) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(1S,3R)-3-(dimethylamino)cyclohexyl]-3-(2-pyridin-3-yloxyethyl)urea.
| Compound Name | 1-[(1S,3R)-3-(dimethylamino)cyclohexyl]-3-(2-pyridin-3-yloxyethyl)urea |
|---|---|
| PubChem CID | 97060602 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-[(1S,3R)-3-(dimethylamino)cyclohexyl]-3-(2-pyridin-3-yloxyethyl)urea |
| SMILES | CN(C)[C@@H]1CCC[C@H](NC(=O)NCCOc2cccnc2)C1 |
| InChI | InChI=1S/C16H26N4O2/c1-20(2)14-6-3-5-13(11-14)19-16(21)18-9-10-22-15-7-4-8-17-12-15/h4,7-8,12-14H,3,5-6,9-11H2,1-2H3,(H2,18,19,21)/t13-,14+/m0/s1 |
| InChIKey | QXZWOXDBDRDGKF-UONOGXRCSA-N |
| XLogP | 1.63 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|