C12H20N4O3S — CID 97061042
N-methyl-N-[2-oxo-2-[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]ethyl]methanesulfonamide (PubChem CID 97061042) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-oxo-2-[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 97061042 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[(3S)-3-(1H-pyrazol-4-yl)piperidin-1-yl]ethyl]methanesulfonamide |
| SMILES | CN(CC(=O)N1CCC[C@@H](c2cn[nH]c2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N4O3S/c1-15(20(2,18)19)9-12(17)16-5-3-4-10(8-16)11-6-13-14-7-11/h6-7,10H,3-5,8-9H2,1-2H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | ZJJVDCAQRJVZTN-SNVBAGLBSA-N |
| XLogP | 0.01 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |