About 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide
1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide (PubChem CID 97061084) has the molecular formula C17H29N3O2
and a molecular weight of 307.44 g/mol. Its IUPAC name is 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide |
| PubChem CID | 97061084 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N[C@@H]2CCCC[C@@H]2OCCC(C)C)cnn1C |
| InChI | InChI=1S/C17H29N3O2/c1-12(2)9-10-22-16-8-6-5-7-15(16)19-17(21)14-11-18-20(4)13(14)3/h11-12,15-16H,5-10H2,1-4H3,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | HDCMWZDTOFCBMD-CVEARBPZSA-N |
| XLogP | 2.83 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide?
The IUPAC name of 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide (CID 97061084) is 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide.
What is the SMILES notation for 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide?
The canonical SMILES for 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide is Cc1c(C(=O)N[C@@H]2CCCC[C@@H]2OCCC(C)C)cnn1C.
What is the InChIKey of 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide?
The InChIKey is HDCMWZDTOFCBMD-CVEARBPZSA-N. The full InChI is InChI=1S/C17H29N3O2/c1-12(2)9-10-22-16-8-6-5-7-15(16)19-17(21)14-11-18-20(4)13(14)3/h11-12,15-16H,5-10H2,1-4H3,(H,19,21)/t15-,16+/m1/s1.
What are the key properties of 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide?
1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide has a molecular weight of 307.44 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-N-[(1R,2S)-2-(3-methylbutoxy)cyclohexyl]pyrazole-4-carboxamide is sourced from PubChem (CID 97061084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).