C17H24N2O3S — CID 97061253
3-[3-[methyl-[(1R,2S)-2-methylsulfonylcyclopentyl]amino]propoxy]benzonitrile (PubChem CID 97061253) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-[3-[methyl-[(1R,2S)-2-methylsulfonylcyclopentyl]amino]propoxy]benzonitrile.
| Compound Name | 3-[3-[methyl-[(1R,2S)-2-methylsulfonylcyclopentyl]amino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 97061253 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-[3-[methyl-[(1R,2S)-2-methylsulfonylcyclopentyl]amino]propoxy]benzonitrile |
| SMILES | CN(CCCOc1cccc(C#N)c1)[C@@H]1CCC[C@@H]1S(C)(=O)=O |
| InChI | InChI=1S/C17H24N2O3S/c1-19(16-8-4-9-17(16)23(2,20)21)10-5-11-22-15-7-3-6-14(12-15)13-18/h3,6-7,12,16-17H,4-5,8-11H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | XQDHYEPOMMCCJQ-SJORKVTESA-N |
| XLogP | 2.22 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|