C20H30FN3O — CID 97062071
3-(4-fluorophenyl)-1-[(3S)-3-(4-methylpiperazin-1-yl)azepan-1-yl]propan-1-one (PubChem CID 97062071) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(3S)-3-(4-methylpiperazin-1-yl)azepan-1-yl]propan-1-one.
| Compound Name | 3-(4-fluorophenyl)-1-[(3S)-3-(4-methylpiperazin-1-yl)azepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 97062071 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(3S)-3-(4-methylpiperazin-1-yl)azepan-1-yl]propan-1-one |
| SMILES | CN1CCN([C@H]2CCCCN(C(=O)CCc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C20H30FN3O/c1-22-12-14-23(15-13-22)19-4-2-3-11-24(16-19)20(25)10-7-17-5-8-18(21)9-6-17/h5-6,8-9,19H,2-4,7,10-16H2,1H3/t19-/m0/s1 |
| InChIKey | YJCKXWZXYIVRIY-IBGZPJMESA-N |
| XLogP | 2.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |