C18H21N3O2S — CID 97063872
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 97063872) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 97063872 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | COc1ccc2c(c1)CCC[C@H]2CC(=O)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C18H21N3O2S/c1-23-14-7-8-15-12(9-14)3-2-4-13(15)10-16(22)19-18-21-20-17(24-18)11-5-6-11/h7-9,11,13H,2-6,10H2,1H3,(H,19,21,22)/t13-/m0/s1 |
| InChIKey | MALHZWOKPOWSGJ-ZDUSSCGKSA-N |
| XLogP | 3.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |