C23H27ClN2O4 — CID 97064150
methyl (2R)-2-(3-chlorophenyl)-2-[4-[3-(2-methoxyphenyl)propanoyl]piperazin-1-yl]acetate (PubChem CID 97064150) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is methyl (2R)-2-(3-chlorophenyl)-2-[4-[3-(2-methoxyphenyl)propanoyl]piperazin-1-yl]acetate.
| Compound Name | methyl (2R)-2-(3-chlorophenyl)-2-[4-[3-(2-methoxyphenyl)propanoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 97064150 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | methyl (2R)-2-(3-chlorophenyl)-2-[4-[3-(2-methoxyphenyl)propanoyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)[C@@H](c1cccc(Cl)c1)N1CCN(C(=O)CCc2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-29-20-9-4-3-6-17(20)10-11-21(27)25-12-14-26(15-13-25)22(23(28)30-2)18-7-5-8-19(24)16-18/h3-9,16,22H,10-15H2,1-2H3/t22-/m1/s1 |
| InChIKey | SZAZZNHLFYVQCM-JOCHJYFZSA-N |
| XLogP | 3.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |