About N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine
N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 97064461) has the molecular formula C16H16N4O4S
and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 97064461 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | CS(=O)(=O)C[C@H](Nc1nc2ccccn2c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H16N4O4S/c1-25(23,24)11-13(12-7-3-2-4-8-12)17-15-16(20(21)22)19-10-6-5-9-14(19)18-15/h2-10,13,17H,11H2,1H3/t13-/m0/s1 |
| InChIKey | DKHQJMFGNYHHID-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine (CID 97064461) is N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine is CS(=O)(=O)C[C@H](Nc1nc2ccccn2c1[N+](=O)[O-])c1ccccc1.
What is the InChIKey of N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is DKHQJMFGNYHHID-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H16N4O4S/c1-25(23,24)11-13(12-7-3-2-4-8-12)17-15-16(20(21)22)19-10-6-5-9-14(19)18-15/h2-10,13,17H,11H2,1H3/t13-/m0/s1.
What are the key properties of N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine?
N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 360.39 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-2-methylsulfonyl-1-phenylethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 97064461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).