About N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide
N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide (PubChem CID 97064545) has the molecular formula C8H12N2O2S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide |
| PubChem CID | 97064545 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H](c1nccs1)C1CC1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-14(11,12)10-7(6-2-3-6)8-9-4-5-13-8/h4-7,10H,2-3H2,1H3/t7-/m0/s1 |
| InChIKey | STRWHSOGXBGNGR-ZETCQYMHSA-N |
| XLogP | 1.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide?
The IUPAC name of N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide (CID 97064545) is N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide.
What is the SMILES notation for N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide?
The canonical SMILES for N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide is CS(=O)(=O)N[C@H](c1nccs1)C1CC1.
What is the InChIKey of N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide?
The InChIKey is STRWHSOGXBGNGR-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H12N2O2S2/c1-14(11,12)10-7(6-2-3-6)8-9-4-5-13-8/h4-7,10H,2-3H2,1H3/t7-/m0/s1.
What are the key properties of N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide?
N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide has a molecular weight of 232.33 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]methanesulfonamide is sourced from PubChem (CID 97064545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).