C15H20F3N3O2 — CID 97065089
2-oxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 97065089) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-oxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-oxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 97065089 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-oxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)N[C@H]1CCCC[C@H]1C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O2/c1-8-12(9(2)21(3)20-8)13(22)14(23)19-11-7-5-4-6-10(11)15(16,17)18/h10-11H,4-7H2,1-3H3,(H,19,23)/t10-,11+/m1/s1 |
| InChIKey | PYOPUIQUUIOHPZ-MNOVXSKESA-N |
| XLogP | 2.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|