About (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine
(3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 97065377) has the molecular formula C21H22N2OS
and a molecular weight of 350.49 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 97065377 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | Cc1nc(Cc2ccccc2)sc1[C@H](C)N[C@H]1COc2ccccc21 |
| InChI | InChI=1S/C21H22N2OS/c1-14(22-18-13-24-19-11-7-6-10-17(18)19)21-15(2)23-20(25-21)12-16-8-4-3-5-9-16/h3-11,14,18,22H,12-13H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | OYTOMXNSICLWAG-KSSFIOAISA-N |
| XLogP | 4.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine (CID 97065377) is (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine is Cc1nc(Cc2ccccc2)sc1[C@H](C)N[C@H]1COc2ccccc21.
What is the InChIKey of (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is OYTOMXNSICLWAG-KSSFIOAISA-N. The full InChI is InChI=1S/C21H22N2OS/c1-14(22-18-13-24-19-11-7-6-10-17(18)19)21-15(2)23-20(25-21)12-16-8-4-3-5-9-16/h3-11,14,18,22H,12-13H2,1-2H3/t14-,18-/m0/s1.
What are the key properties of (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine?
(3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 350.49 g/mol, XLogP of 4.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[(1S)-1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethyl]-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 97065377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).