C23H22FN3O — CID 97065618
2-[1-(2-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S)-1-phenylbut-3-ynyl]acetamide (PubChem CID 97065618) has the molecular formula C23H22FN3O and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S)-1-phenylbut-3-ynyl]acetamide.
| Compound Name | 2-[1-(2-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S)-1-phenylbut-3-ynyl]acetamide |
|---|---|
| PubChem CID | 97065618 |
| Molecular Formula | C23H22FN3O |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S)-1-phenylbut-3-ynyl]acetamide |
| SMILES | C#CC[C@H](NC(=O)Cc1c(C)nn(-c2ccccc2F)c1C)c1ccccc1 |
| InChI | InChI=1S/C23H22FN3O/c1-4-10-21(18-11-6-5-7-12-18)25-23(28)15-19-16(2)26-27(17(19)3)22-14-9-8-13-20(22)24/h1,5-9,11-14,21H,10,15H2,2-3H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | CLTCDTCGRVCPPS-NRFANRHFSA-N |
| XLogP | 4.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|