About 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one
3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one (PubChem CID 97066448) has the molecular formula C15H20N6O2
and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one |
| PubChem CID | 97066448 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one |
| SMILES | Cc1c(C(=O)N2CCN(C)C[C@H]2C)cnn1-c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C15H20N6O2/c1-10-9-19(3)6-7-20(10)15(23)12-8-16-21(11(12)2)13-4-5-14(22)18-17-13/h4-5,8,10H,6-7,9H2,1-3H3,(H,18,22)/t10-/m1/s1 |
| InChIKey | YWGODLODEQKVLV-SNVBAGLBSA-N |
| XLogP | 0.04 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one?
The IUPAC name of 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one (CID 97066448) is 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one.
What is the SMILES notation for 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one?
The canonical SMILES for 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one is Cc1c(C(=O)N2CCN(C)C[C@H]2C)cnn1-c1ccc(=O)[nH]n1.
What is the InChIKey of 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one?
The InChIKey is YWGODLODEQKVLV-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H20N6O2/c1-10-9-19(3)6-7-20(10)15(23)12-8-16-21(11(12)2)13-4-5-14(22)18-17-13/h4-5,8,10H,6-7,9H2,1-3H3,(H,18,22)/t10-/m1/s1.
What are the key properties of 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one?
3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one has a molecular weight of 316.37 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2R)-2,4-dimethylpiperazine-1-carbonyl]-5-methylpyrazol-1-yl]-1H-pyridazin-6-one is sourced from PubChem (CID 97066448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).