C16H15N3O7S — CID 97067745
4-hydroxy-2-methyl-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-5-nitrobenzenesulfonamide (PubChem CID 97067745) has the molecular formula C16H15N3O7S and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-5-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-2-methyl-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 97067745 |
| Molecular Formula | C16H15N3O7S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-hydroxy-2-methyl-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(O)c([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 |
| InChI | InChI=1S/C16H15N3O7S/c1-8-5-13(20)12(19(22)23)7-15(8)27(24,25)18-10-3-4-14-11(6-10)17-16(21)9(2)26-14/h3-7,9,18,20H,1-2H3,(H,17,21)/t9-/m0/s1 |
| InChIKey | QDVIITQZSDCMQD-VIFPVBQESA-N |
| XLogP | 2.13 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|