About (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine
(3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 97068464) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 97068464 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | Cc1cc(C)n(-c2ccc(CN(C)[C@H]3CCS(=O)(=O)C3)cc2)n1 |
| InChI | InChI=1S/C17H23N3O2S/c1-13-10-14(2)20(18-13)16-6-4-15(5-7-16)11-19(3)17-8-9-23(21,22)12-17/h4-7,10,17H,8-9,11-12H2,1-3H3/t17-/m0/s1 |
| InChIKey | KHOIXMGEUKHHSP-KRWDZBQOSA-N |
| XLogP | 2.11 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine (CID 97068464) is (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine is Cc1cc(C)n(-c2ccc(CN(C)[C@H]3CCS(=O)(=O)C3)cc2)n1.
What is the InChIKey of (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is KHOIXMGEUKHHSP-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H23N3O2S/c1-13-10-14(2)20(18-13)16-6-4-15(5-7-16)11-19(3)17-8-9-23(21,22)12-17/h4-7,10,17H,8-9,11-12H2,1-3H3/t17-/m0/s1.
What are the key properties of (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
(3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 333.46 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 97068464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).