About (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide
(3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide (PubChem CID 97068654) has the molecular formula C15H25N3O4
and a molecular weight of 311.38 g/mol. Its IUPAC name is (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide |
| PubChem CID | 97068654 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)CN2CCCC3(C2)OCCO3)C1 |
| InChI | InChI=1S/C15H25N3O4/c16-14(20)12-3-1-6-18(9-12)13(19)10-17-5-2-4-15(11-17)21-7-8-22-15/h12H,1-11H2,(H2,16,20)/t12-/m1/s1 |
| InChIKey | ALDKIWDWFFUYSP-GFCCVEGCSA-N |
| XLogP | -0.45 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide?
The IUPAC name of (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide (CID 97068654) is (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide.
What is the SMILES notation for (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide?
The canonical SMILES for (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide is NC(=O)[C@@H]1CCCN(C(=O)CN2CCCC3(C2)OCCO3)C1.
What is the InChIKey of (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide?
The InChIKey is ALDKIWDWFFUYSP-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H25N3O4/c16-14(20)12-3-1-6-18(9-12)13(19)10-17-5-2-4-15(11-17)21-7-8-22-15/h12H,1-11H2,(H2,16,20)/t12-/m1/s1.
What are the key properties of (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide?
(3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide has a molecular weight of 311.38 g/mol, XLogP of -0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)acetyl]piperidine-3-carboxamide is sourced from PubChem (CID 97068654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).