C17H29N3O2 — CID 97068849
1-[(2S)-3,3-dimethylbutan-2-yl]-3-[[2-(2-methoxyethylamino)phenyl]methyl]urea (PubChem CID 97068849) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[(2S)-3,3-dimethylbutan-2-yl]-3-[[2-(2-methoxyethylamino)phenyl]methyl]urea.
| Compound Name | 1-[(2S)-3,3-dimethylbutan-2-yl]-3-[[2-(2-methoxyethylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 97068849 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-[(2S)-3,3-dimethylbutan-2-yl]-3-[[2-(2-methoxyethylamino)phenyl]methyl]urea |
| SMILES | COCCNc1ccccc1CNC(=O)N[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C17H29N3O2/c1-13(17(2,3)4)20-16(21)19-12-14-8-6-7-9-15(14)18-10-11-22-5/h6-9,13,18H,10-12H2,1-5H3,(H2,19,20,21)/t13-/m0/s1 |
| InChIKey | VGGMUJOARPCONB-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|