C9H14F3N3OS — CID 97068994
4-(3-methoxypropyl)-3-[(2R)-1,1,1-trifluoropropan-2-yl]sulfanyl-1,2,4-triazole (PubChem CID 97068994) has the molecular formula C9H14F3N3OS and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-3-[(2R)-1,1,1-trifluoropropan-2-yl]sulfanyl-1,2,4-triazole.
| Compound Name | 4-(3-methoxypropyl)-3-[(2R)-1,1,1-trifluoropropan-2-yl]sulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 97068994 |
| Molecular Formula | C9H14F3N3OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-(3-methoxypropyl)-3-[(2R)-1,1,1-trifluoropropan-2-yl]sulfanyl-1,2,4-triazole |
| SMILES | COCCCn1cnnc1S[C@H](C)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N3OS/c1-7(9(10,11)12)17-8-14-13-6-15(8)4-3-5-16-2/h6-7H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | QGYZYISYEFHASR-SSDOTTSWSA-N |
| XLogP | 2.36 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|