About N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide
N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide (PubChem CID 97069017) has the molecular formula C13H15F2N3O3S
and a molecular weight of 331.34 g/mol. Its IUPAC name is N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide |
| PubChem CID | 97069017 |
| Molecular Formula | C13H15F2N3O3S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1cnn(C)c1)[C@H](O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2N3O3S/c1-8(13(19)9-3-4-11(14)12(15)5-9)17-22(20,21)10-6-16-18(2)7-10/h3-8,13,17,19H,1-2H3/t8-,13-/m0/s1 |
| InChIKey | DCOVUAWCMFTZPG-SDBXPKJASA-N |
| XLogP | 1.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide?
The IUPAC name of N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide (CID 97069017) is N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide.
What is the SMILES notation for N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide?
The canonical SMILES for N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide is C[C@H](NS(=O)(=O)c1cnn(C)c1)[C@H](O)c1ccc(F)c(F)c1.
What is the InChIKey of N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide?
The InChIKey is DCOVUAWCMFTZPG-SDBXPKJASA-N. The full InChI is InChI=1S/C13H15F2N3O3S/c1-8(13(19)9-3-4-11(14)12(15)5-9)17-22(20,21)10-6-16-18(2)7-10/h3-8,13,17,19H,1-2H3/t8-,13-/m0/s1.
What are the key properties of N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide?
N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide has a molecular weight of 331.34 g/mol, XLogP of 1.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-1-(3,4-difluorophenyl)-1-hydroxypropan-2-yl]-1-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 97069017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).