C15H20ClN3O3 — CID 97069316
5-[(6-chloro-4-methyl-3-pyridinyl)oxymethyl]-3-[(1R)-1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole (PubChem CID 97069316) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 5-[(6-chloro-4-methyl-3-pyridinyl)oxymethyl]-3-[(1R)-1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole.
| Compound Name | 5-[(6-chloro-4-methyl-3-pyridinyl)oxymethyl]-3-[(1R)-1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97069316 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-[(6-chloro-4-methyl-3-pyridinyl)oxymethyl]-3-[(1R)-1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole |
| SMILES | Cc1cc(Cl)ncc1OCc1nc([C@@H](C)OCC(C)C)no1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-9(2)7-20-11(4)15-18-14(22-19-15)8-21-12-6-17-13(16)5-10(12)3/h5-6,9,11H,7-8H2,1-4H3/t11-/m1/s1 |
| InChIKey | XAKRCRAEWBDOQK-LLVKDONJSA-N |
| XLogP | 3.74 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|