About N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide
N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 97069377) has the molecular formula C15H15BrN2O2
and a molecular weight of 335.20 g/mol. Its IUPAC name is N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 97069377 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)N[C@@H]2C[C@H]2c2ccc(Br)cc2)no1 |
| InChI | InChI=1S/C15H15BrN2O2/c1-9-6-12(18-20-9)7-15(19)17-14-8-13(14)10-2-4-11(16)5-3-10/h2-6,13-14H,7-8H2,1H3,(H,17,19)/t13-,14+/m0/s1 |
| InChIKey | GDLMECBVLZJRMP-UONOGXRCSA-N |
| XLogP | 2.96 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide (CID 97069377) is N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide is Cc1cc(CC(=O)N[C@@H]2C[C@H]2c2ccc(Br)cc2)no1.
What is the InChIKey of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is GDLMECBVLZJRMP-UONOGXRCSA-N. The full InChI is InChI=1S/C15H15BrN2O2/c1-9-6-12(18-20-9)7-15(19)17-14-8-13(14)10-2-4-11(16)5-3-10/h2-6,13-14H,7-8H2,1H3,(H,17,19)/t13-,14+/m0/s1.
What are the key properties of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 335.20 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 97069377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).