C11H19NO3S — CID 97070512
(2S)-1-ethylsulfonyl-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine (PubChem CID 97070512) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is (2S)-1-ethylsulfonyl-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine.
| Compound Name | (2S)-1-ethylsulfonyl-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 97070512 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (2S)-1-ethylsulfonyl-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine |
| SMILES | CCS(=O)(=O)C[C@H](C)N[C@H](C)c1ccco1 |
| InChI | InChI=1S/C11H19NO3S/c1-4-16(13,14)8-9(2)12-10(3)11-6-5-7-15-11/h5-7,9-10,12H,4,8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | QUEMIDGVIGJMOF-VHSXEESVSA-N |
| XLogP | 1.75 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |