C17H17N5O — CID 97071015
5-[(2S)-1-benzylpyrrolidin-2-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole (PubChem CID 97071015) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 5-[(2S)-1-benzylpyrrolidin-2-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(2S)-1-benzylpyrrolidin-2-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97071015 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[(2S)-1-benzylpyrrolidin-2-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(CN2CCC[C@H]2c2nc(-c3cnccn3)no2)cc1 |
| InChI | InChI=1S/C17H17N5O/c1-2-5-13(6-3-1)12-22-10-4-7-15(22)17-20-16(21-23-17)14-11-18-8-9-19-14/h1-3,5-6,8-9,11,15H,4,7,10,12H2/t15-/m0/s1 |
| InChIKey | WCUNQKLIMLRCCL-HNNXBMFYSA-N |
| XLogP | 2.86 |
| TPSA | 67.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |