C13H27N3O4S — CID 97071902
tert-butyl (3S)-3-(dimethylsulfamoylamino)azepane-1-carboxylate (PubChem CID 97071902) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is tert-butyl (3S)-3-(dimethylsulfamoylamino)azepane-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(dimethylsulfamoylamino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 97071902 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl (3S)-3-(dimethylsulfamoylamino)azepane-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)N[C@H]1CCCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N3O4S/c1-13(2,3)20-12(17)16-9-7-6-8-11(10-16)14-21(18,19)15(4)5/h11,14H,6-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | ISCKVGDQFLNTPJ-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |