C14H19NO3 — CID 97072881
(3R)-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 97072881) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (3R)-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3R)-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 97072881 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3R)-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CC(C)(C)ONC(=O)[C@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C14H19NO3/c1-14(2,3)18-15-13(16)11-8-10-6-4-5-7-12(10)17-9-11/h4-7,11H,8-9H2,1-3H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | HBEJGRVFVAXAEZ-LLVKDONJSA-N |
| XLogP | 2.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|