C15H22N4S — CID 97073272
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-[(8R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methanamine (PubChem CID 97073272) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-[(8R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methanamine.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-[(8R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methanamine |
|---|---|
| PubChem CID | 97073272 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-[(8R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methanamine |
| SMILES | Cc1cn2c(n1)[C@@H](CNCc1sc(C)nc1C)CCC2 |
| InChI | InChI=1S/C15H22N4S/c1-10-9-19-6-4-5-13(15(19)17-10)7-16-8-14-11(2)18-12(3)20-14/h9,13,16H,4-8H2,1-3H3/t13-/m1/s1 |
| InChIKey | XJNWCYRHKBHEKL-CYBMUJFWSA-N |
| XLogP | 2.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |