About 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one
6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one (PubChem CID 97073638) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one |
| PubChem CID | 97073638 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one |
| SMILES | C[C@@H]1CN(C(=O)Cn2cnc(C3CCC3)cc2=O)C[C@@H](C)O1 |
| InChI | InChI=1S/C16H23N3O3/c1-11-7-18(8-12(2)22-11)16(21)9-19-10-17-14(6-15(19)20)13-4-3-5-13/h6,10-13H,3-5,7-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | LAMLENQIUACMRT-VXGBXAGGSA-N |
| XLogP | 1.15 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one?
The IUPAC name of 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one (CID 97073638) is 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one.
What is the SMILES notation for 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one?
The canonical SMILES for 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one is C[C@@H]1CN(C(=O)Cn2cnc(C3CCC3)cc2=O)C[C@@H](C)O1.
What is the InChIKey of 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one?
The InChIKey is LAMLENQIUACMRT-VXGBXAGGSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-11-7-18(8-12(2)22-11)16(21)9-19-10-17-14(6-15(19)20)13-4-3-5-13/h6,10-13H,3-5,7-9H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one?
6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one has a molecular weight of 305.38 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclobutyl-3-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyrimidin-4-one is sourced from PubChem (CID 97073638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).