C22H29FN4O2S — CID 97073734
1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]urea (PubChem CID 97073734) has the molecular formula C22H29FN4O2S and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]urea.
| Compound Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]urea |
|---|---|
| PubChem CID | 97073734 |
| Molecular Formula | C22H29FN4O2S |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-3-[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]urea |
| SMILES | Cc1csc(C2(NC(=O)Nc3ccc(N4C[C@@H](C)O[C@@H](C)C4)c(F)c3)CCCC2)n1 |
| InChI | InChI=1S/C22H29FN4O2S/c1-14-13-30-20(24-14)22(8-4-5-9-22)26-21(28)25-17-6-7-19(18(23)10-17)27-11-15(2)29-16(3)12-27/h6-7,10,13,15-16H,4-5,8-9,11-12H2,1-3H3,(H2,25,26,28)/t15-,16+ |
| InChIKey | PBIYLBYLDNNLMH-IYBDPMFKSA-N |
| XLogP | 4.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|