C16H19FN4O2 — CID 97074233
1-[(1R,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]urea (PubChem CID 97074233) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-[(1R,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]urea.
| Compound Name | 1-[(1R,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 97074233 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[(1R,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)N[C@H]2c3cccc(F)c3CC[C@@H]2C)no1 |
| InChI | InChI=1S/C16H19FN4O2/c1-9-6-7-11-12(4-3-5-13(11)17)15(9)20-16(22)18-8-14-19-10(2)23-21-14/h3-5,9,15H,6-8H2,1-2H3,(H2,18,20,22)/t9-,15+/m0/s1 |
| InChIKey | OGTTZNOLBGHRNN-BJOHPYRUSA-N |
| XLogP | 2.64 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |