C18H29N5S — CID 97074509
5-[[[(8R)-2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]methyl]-N,N-dimethyl-1,3-thiazol-2-amine (PubChem CID 97074509) has the molecular formula C18H29N5S and a molecular weight of 347.53 g/mol. Its IUPAC name is 5-[[[(8R)-2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]methyl]-N,N-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[[[(8R)-2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 97074509 |
| Molecular Formula | C18H29N5S |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 5-[[[(8R)-2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
| SMILES | CN(C)c1ncc(CNC[C@H]2CCCn3cc(C(C)(C)C)nc32)s1 |
| InChI | InChI=1S/C18H29N5S/c1-18(2,3)15-12-23-8-6-7-13(16(23)21-15)9-19-10-14-11-20-17(24-14)22(4)5/h11-13,19H,6-10H2,1-5H3/t13-/m1/s1 |
| InChIKey | WAWMHMGSXZDRDW-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |