About [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone
[(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone (PubChem CID 97074666) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone.
Molecular Properties
| Compound Name | [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone |
| PubChem CID | 97074666 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone |
| SMILES | Cc1nccc(C(=O)N2CCN(C)C[C@@H]2C)n1 |
| InChI | InChI=1S/C12H18N4O/c1-9-8-15(3)6-7-16(9)12(17)11-4-5-13-10(2)14-11/h4-5,9H,6-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | RVIOYJAINOOYQO-VIFPVBQESA-N |
| XLogP | 0.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone?
The IUPAC name of [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone (CID 97074666) is [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone.
What is the SMILES notation for [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone?
The canonical SMILES for [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone is Cc1nccc(C(=O)N2CCN(C)C[C@@H]2C)n1.
What is the InChIKey of [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone?
The InChIKey is RVIOYJAINOOYQO-VIFPVBQESA-N. The full InChI is InChI=1S/C12H18N4O/c1-9-8-15(3)6-7-16(9)12(17)11-4-5-13-10(2)14-11/h4-5,9H,6-8H2,1-3H3/t9-/m0/s1.
What are the key properties of [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone?
[(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone has a molecular weight of 234.30 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2,4-dimethylpiperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone is sourced from PubChem (CID 97074666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).