C18H19N5OS — CID 97075005
(6S)-3-methyl-N-[(R)-phenyl(1,3-thiazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 97075005) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is (6S)-3-methyl-N-[(R)-phenyl(1,3-thiazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | (6S)-3-methyl-N-[(R)-phenyl(1,3-thiazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97075005 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (6S)-3-methyl-N-[(R)-phenyl(1,3-thiazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | Cc1nnc2n1C[C@@H](C(=O)N[C@H](c1ccccc1)c1nccs1)CC2 |
| InChI | InChI=1S/C18H19N5OS/c1-12-21-22-15-8-7-14(11-23(12)15)17(24)20-16(18-19-9-10-25-18)13-5-3-2-4-6-13/h2-6,9-10,14,16H,7-8,11H2,1H3,(H,20,24)/t14-,16+/m0/s1 |
| InChIKey | KIWXTHPAMYZDOO-GOEBONIOSA-N |
| XLogP | 2.51 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |