C18H24N6O — CID 97075628
(3R)-1-(1-methylpyrazol-4-yl)-3-(4-pyridin-4-ylpiperazin-1-yl)piperidin-2-one (PubChem CID 97075628) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is (3R)-1-(1-methylpyrazol-4-yl)-3-(4-pyridin-4-ylpiperazin-1-yl)piperidin-2-one.
| Compound Name | (3R)-1-(1-methylpyrazol-4-yl)-3-(4-pyridin-4-ylpiperazin-1-yl)piperidin-2-one |
|---|---|
| PubChem CID | 97075628 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (3R)-1-(1-methylpyrazol-4-yl)-3-(4-pyridin-4-ylpiperazin-1-yl)piperidin-2-one |
| SMILES | Cn1cc(N2CCC[C@@H](N3CCN(c4ccncc4)CC3)C2=O)cn1 |
| InChI | InChI=1S/C18H24N6O/c1-21-14-16(13-20-21)24-8-2-3-17(18(24)25)23-11-9-22(10-12-23)15-4-6-19-7-5-15/h4-7,13-14,17H,2-3,8-12H2,1H3/t17-/m1/s1 |
| InChIKey | KWMUNJRURIWGNP-QGZVFWFLSA-N |
| XLogP | 1.13 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |