About (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol
(1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol (PubChem CID 97076671) has the molecular formula C13H15F2N5O
and a molecular weight of 295.29 g/mol. Its IUPAC name is (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol |
| PubChem CID | 97076671 |
| Molecular Formula | C13H15F2N5O |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol |
| SMILES | O[C@@H](CNCc1nnnn1C1CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2N5O/c14-10-4-1-8(5-11(10)15)12(21)6-16-7-13-17-18-19-20(13)9-2-3-9/h1,4-5,9,12,16,21H,2-3,6-7H2/t12-/m0/s1 |
| InChIKey | KPYXLJRPDYMLPS-LBPRGKRZSA-N |
| XLogP | 1.11 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol?
The IUPAC name of (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol (CID 97076671) is (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol.
What is the SMILES notation for (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol?
The canonical SMILES for (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol is O[C@@H](CNCc1nnnn1C1CC1)c1ccc(F)c(F)c1.
What is the InChIKey of (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol?
The InChIKey is KPYXLJRPDYMLPS-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H15F2N5O/c14-10-4-1-8(5-11(10)15)12(21)6-16-7-13-17-18-19-20(13)9-2-3-9/h1,4-5,9,12,16,21H,2-3,6-7H2/t12-/m0/s1.
What are the key properties of (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol?
(1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol has a molecular weight of 295.29 g/mol, XLogP of 1.11, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[(1-cyclopropyltetrazol-5-yl)methylamino]-1-(3,4-difluorophenyl)ethanol is sourced from PubChem (CID 97076671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).